About adamantane;1,3-dioxolan-2-one
adamantane;1,3-dioxolan-2-one (PubChem CID 175094584) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is adamantane;1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | adamantane;1,3-dioxolan-2-one |
| PubChem CID | 175094584 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | adamantane;1,3-dioxolan-2-one |
| SMILES | C1C2CC3CC1CC(C2)C3.O=C1OCCO1 |
| InChI | InChI=1S/C10H16.C3H4O3/c1-7-2-9-4-8(1)5-10(3-7)6-9;4-3-5-1-2-6-3/h7-10H,1-6H2;1-2H2 |
| InChIKey | RRBPDUCBVUOXLG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze adamantane;1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of adamantane;1,3-dioxolan-2-one?
The IUPAC name of adamantane;1,3-dioxolan-2-one (CID 175094584) is adamantane;1,3-dioxolan-2-one.
What is the SMILES notation for adamantane;1,3-dioxolan-2-one?
The canonical SMILES for adamantane;1,3-dioxolan-2-one is C1C2CC3CC1CC(C2)C3.O=C1OCCO1.
What is the InChIKey of adamantane;1,3-dioxolan-2-one?
The InChIKey is RRBPDUCBVUOXLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C3H4O3/c1-7-2-9-4-8(1)5-10(3-7)6-9;4-3-5-1-2-6-3/h7-10H,1-6H2;1-2H2.
What are the key properties of adamantane;1,3-dioxolan-2-one?
adamantane;1,3-dioxolan-2-one has a molecular weight of 224.30 g/mol, XLogP of 2.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for adamantane;1,3-dioxolan-2-one is sourced from PubChem (CID 175094584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).