About lithium;1,3-dioxolan-2-one;hexafluorophosphate
lithium;1,3-dioxolan-2-one;hexafluorophosphate (PubChem CID 146442279) has the molecular formula C3H4F6LiO3P
and a molecular weight of 239.96 g/mol. Its IUPAC name is lithium;1,3-dioxolan-2-one;hexafluorophosphate.
Molecular Properties
| Compound Name | lithium;1,3-dioxolan-2-one;hexafluorophosphate |
| PubChem CID | 146442279 |
| Molecular Formula | C3H4F6LiO3P |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | lithium;1,3-dioxolan-2-one;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=C1OCCO1.[Li+] |
| InChI | InChI=1S/C3H4O3.F6P.Li/c4-3-5-1-2-6-3;1-7(2,3,4,5)6;/h1-2H2;;/q;-1;+1 |
| InChIKey | KGZSRLOBZAZIII-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;1,3-dioxolan-2-one;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;1,3-dioxolan-2-one;hexafluorophosphate?
The IUPAC name of lithium;1,3-dioxolan-2-one;hexafluorophosphate (CID 146442279) is lithium;1,3-dioxolan-2-one;hexafluorophosphate.
What is the SMILES notation for lithium;1,3-dioxolan-2-one;hexafluorophosphate?
The canonical SMILES for lithium;1,3-dioxolan-2-one;hexafluorophosphate is F[P-](F)(F)(F)(F)F.O=C1OCCO1.[Li+].
What is the InChIKey of lithium;1,3-dioxolan-2-one;hexafluorophosphate?
The InChIKey is KGZSRLOBZAZIII-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O3.F6P.Li/c4-3-5-1-2-6-3;1-7(2,3,4,5)6;/h1-2H2;;/q;-1;+1.
What are the key properties of lithium;1,3-dioxolan-2-one;hexafluorophosphate?
lithium;1,3-dioxolan-2-one;hexafluorophosphate has a molecular weight of 239.96 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;1,3-dioxolan-2-one;hexafluorophosphate is sourced from PubChem (CID 146442279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).