C3H4F6LiO3P — CID 146442279
lithium;1,3-dioxolan-2-one;hexafluorophosphate (PubChem CID 146442279) has the molecular formula C3H4F6LiO3P and a molecular weight of 239.96 g/mol. Its IUPAC name is lithium;1,3-dioxolan-2-one;hexafluorophosphate.
| Compound Name | lithium;1,3-dioxolan-2-one;hexafluorophosphate |
|---|---|
| PubChem CID | 146442279 |
| Molecular Formula | C3H4F6LiO3P |
| Molecular Weight | 239.96 g/mol |
| Exact Mass | 240.00 |
| IUPAC Name | lithium;1,3-dioxolan-2-one;hexafluorophosphate |
| SMILES | F[P-](F)(F)(F)(F)F.O=C1OCCO1.[Li+] |
| InChI | InChI=1S/C3H4O3.F6P.Li/c4-3-5-1-2-6-3;1-7(2,3,4,5)6;/h1-2H2;;/q;-1;+1 |
| InChIKey | KGZSRLOBZAZIII-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.96 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|