About 1,3-dioxolan-2-one;pyrrolidine-2,5-dione
1,3-dioxolan-2-one;pyrrolidine-2,5-dione (PubChem CID 66849817) has the molecular formula C7H9NO5
and a molecular weight of 187.15 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 1,3-dioxolan-2-one;pyrrolidine-2,5-dione |
| PubChem CID | 66849817 |
| Molecular Formula | C7H9NO5 |
| Molecular Weight | 187.15 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 1,3-dioxolan-2-one;pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1.O=C1OCCO1 |
| InChI | InChI=1S/C4H5NO2.C3H4O3/c6-3-1-2-4(7)5-3;4-3-5-1-2-6-3/h1-2H2,(H,5,6,7);1-2H2 |
| InChIKey | HXNDLUWXEVKDTC-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.15 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dioxolan-2-one;pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dioxolan-2-one;pyrrolidine-2,5-dione?
The IUPAC name of 1,3-dioxolan-2-one;pyrrolidine-2,5-dione (CID 66849817) is 1,3-dioxolan-2-one;pyrrolidine-2,5-dione.
What is the SMILES notation for 1,3-dioxolan-2-one;pyrrolidine-2,5-dione?
The canonical SMILES for 1,3-dioxolan-2-one;pyrrolidine-2,5-dione is O=C1CCC(=O)N1.O=C1OCCO1.
What is the InChIKey of 1,3-dioxolan-2-one;pyrrolidine-2,5-dione?
The InChIKey is HXNDLUWXEVKDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2.C3H4O3/c6-3-1-2-4(7)5-3;4-3-5-1-2-6-3/h1-2H2,(H,5,6,7);1-2H2.
What are the key properties of 1,3-dioxolan-2-one;pyrrolidine-2,5-dione?
1,3-dioxolan-2-one;pyrrolidine-2,5-dione has a molecular weight of 187.15 g/mol, XLogP of -0.42, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dioxolan-2-one;pyrrolidine-2,5-dione is sourced from PubChem (CID 66849817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).