C10H16O6 — CID 67254769
1,3,8,10-tetraoxacyclotetradecane-2,9-dione (PubChem CID 67254769) has the molecular formula C10H16O6 and a molecular weight of 232.23 g/mol. Its IUPAC name is 1,3,8,10-tetraoxacyclotetradecane-2,9-dione.
| Compound Name | 1,3,8,10-tetraoxacyclotetradecane-2,9-dione |
|---|---|
| PubChem CID | 67254769 |
| Molecular Formula | C10H16O6 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1,3,8,10-tetraoxacyclotetradecane-2,9-dione |
| SMILES | O=C1OCCCCOC(=O)OCCCCO1 |
| InChI | InChI=1S/C10H16O6/c11-9-13-5-1-2-6-14-10(12)16-8-4-3-7-15-9/h1-8H2 |
| InChIKey | KGBCZKSFVVEERO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |