C6H5Br2FO6 — CID 67442671
4,4-dibromo-1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one (PubChem CID 67442671) has the molecular formula C6H5Br2FO6 and a molecular weight of 351.91 g/mol. Its IUPAC name is 4,4-dibromo-1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one.
| Compound Name | 4,4-dibromo-1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 67442671 |
| Molecular Formula | C6H5Br2FO6 |
| Molecular Weight | 351.91 g/mol |
| Exact Mass | 349.84 |
| IUPAC Name | 4,4-dibromo-1,3-dioxolan-2-one;4-fluoro-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(Br)(Br)O1.O=C1OCC(F)O1 |
| InChI | InChI=1S/C3H2Br2O3.C3H3FO3/c4-3(5)1-7-2(6)8-3;4-2-1-6-3(5)7-2/h1H2;2H,1H2 |
| InChIKey | ZUJCTKUCBXMYQS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.91 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|