C6H6Cl2O5P+ — CID 130463840
3,3-dichloroprop-2-enoxy-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium (PubChem CID 130463840) has the molecular formula C6H6Cl2O5P+ and a molecular weight of 259.99 g/mol. Its IUPAC name is 3,3-dichloroprop-2-enoxy-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium.
| Compound Name | 3,3-dichloroprop-2-enoxy-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
|---|---|
| PubChem CID | 130463840 |
| Molecular Formula | C6H6Cl2O5P+ |
| Molecular Weight | 259.99 g/mol |
| Exact Mass | 258.93 |
| IUPAC Name | 3,3-dichloroprop-2-enoxy-oxo-(2-oxo-1,3-dioxolan-4-yl)phosphanium |
| SMILES | O=C1OCC([P+](=O)OCC=C(Cl)Cl)O1 |
| InChI | InChI=1S/C6H6Cl2O5P/c7-4(8)1-2-12-14(10)5-3-11-6(9)13-5/h1,5H,2-3H2/q+1 |
| InChIKey | BVSZWYDLPXOQCB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.99 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|