About 4,5-dihydroxy-1,3-dioxan-2-one
4,5-dihydroxy-1,3-dioxan-2-one (PubChem CID 139816851) has the molecular formula C4H6O5
and a molecular weight of 134.09 g/mol. Its IUPAC name is 4,5-dihydroxy-1,3-dioxan-2-one.
Molecular Properties
| Compound Name | 4,5-dihydroxy-1,3-dioxan-2-one |
| PubChem CID | 139816851 |
| Molecular Formula | C4H6O5 |
| Molecular Weight | 134.09 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 4,5-dihydroxy-1,3-dioxan-2-one |
| SMILES | O=C1OCC(O)C(O)O1 |
| InChI | InChI=1S/C4H6O5/c5-2-1-8-4(7)9-3(2)6/h2-3,5-6H,1H2 |
| InChIKey | BRUBLNSZYBGQRP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.09 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4,5-dihydroxy-1,3-dioxan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydroxy-1,3-dioxan-2-one?
The IUPAC name of 4,5-dihydroxy-1,3-dioxan-2-one (CID 139816851) is 4,5-dihydroxy-1,3-dioxan-2-one.
What is the SMILES notation for 4,5-dihydroxy-1,3-dioxan-2-one?
The canonical SMILES for 4,5-dihydroxy-1,3-dioxan-2-one is O=C1OCC(O)C(O)O1.
What is the InChIKey of 4,5-dihydroxy-1,3-dioxan-2-one?
The InChIKey is BRUBLNSZYBGQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O5/c5-2-1-8-4(7)9-3(2)6/h2-3,5-6H,1H2.
What are the key properties of 4,5-dihydroxy-1,3-dioxan-2-one?
4,5-dihydroxy-1,3-dioxan-2-one has a molecular weight of 134.09 g/mol, XLogP of -1.17, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxy-1,3-dioxan-2-one is sourced from PubChem (CID 139816851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).