C4H6O5 — CID 139816851
4,5-dihydroxy-1,3-dioxan-2-one (PubChem CID 139816851) has the molecular formula C4H6O5 and a molecular weight of 134.09 g/mol. Its IUPAC name is 4,5-dihydroxy-1,3-dioxan-2-one.
| Compound Name | 4,5-dihydroxy-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 139816851 |
| Molecular Formula | C4H6O5 |
| Molecular Weight | 134.09 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | 4,5-dihydroxy-1,3-dioxan-2-one |
| SMILES | O=C1OCC(O)C(O)O1 |
| InChI | InChI=1S/C4H6O5/c5-2-1-8-4(7)9-3(2)6/h2-3,5-6H,1H2 |
| InChIKey | BRUBLNSZYBGQRP-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.09 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |