C6H8O7 — CID 159173945
4-methyl-1,3-dioxolan-2-one;oxalic acid (PubChem CID 159173945) has the molecular formula C6H8O7 and a molecular weight of 192.12 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;oxalic acid.
| Compound Name | 4-methyl-1,3-dioxolan-2-one;oxalic acid |
|---|---|
| PubChem CID | 159173945 |
| Molecular Formula | C6H8O7 |
| Molecular Weight | 192.12 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one;oxalic acid |
| SMILES | CC1COC(=O)O1.O=C(O)C(=O)O |
| InChI | InChI=1S/C4H6O3.C2H2O4/c1-3-2-6-4(5)7-3;3-1(4)2(5)6/h3H,2H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | KMARMRNBPKGDPP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.12 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|