C10H20O6 — CID 160655445
hexane-1,1,1-triol;4-methyl-1,3-dioxolan-2-one (PubChem CID 160655445) has the molecular formula C10H20O6 and a molecular weight of 236.26 g/mol. Its IUPAC name is hexane-1,1,1-triol;4-methyl-1,3-dioxolan-2-one.
| Compound Name | hexane-1,1,1-triol;4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 160655445 |
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | hexane-1,1,1-triol;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1COC(=O)O1.CCCCCC(O)(O)O |
| InChI | InChI=1S/C6H14O3.C4H6O3/c1-2-3-4-5-6(7,8)9;1-3-2-6-4(5)7-3/h7-9H,2-5H2,1H3;3H,2H2,1H3 |
| InChIKey | RKZDVJXXUQXJCF-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|