C8H14O6 — CID 135304393
ethyl methyl carbonate;4-methyl-1,3-dioxolan-2-one (PubChem CID 135304393) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is ethyl methyl carbonate;4-methyl-1,3-dioxolan-2-one.
| Compound Name | ethyl methyl carbonate;4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 135304393 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | ethyl methyl carbonate;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1COC(=O)O1.CCOC(=O)OC |
| InChI | InChI=1S/C4H6O3.C4H8O3/c1-3-2-6-4(5)7-3;1-3-7-4(5)6-2/h3H,2H2,1H3;3H2,1-2H3 |
| InChIKey | RCDSGRIETNCXGP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |