C8H16O5S — CID 174868758
1-(1-hydroxyethylsulfanyl)ethanol;4-methyl-1,3-dioxolan-2-one (PubChem CID 174868758) has the molecular formula C8H16O5S and a molecular weight of 224.28 g/mol. Its IUPAC name is 1-(1-hydroxyethylsulfanyl)ethanol;4-methyl-1,3-dioxolan-2-one.
| Compound Name | 1-(1-hydroxyethylsulfanyl)ethanol;4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 174868758 |
| Molecular Formula | C8H16O5S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 1-(1-hydroxyethylsulfanyl)ethanol;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC(O)SC(C)O.CC1COC(=O)O1 |
| InChI | InChI=1S/C4H6O3.C4H10O2S/c1-3-2-6-4(5)7-3;1-3(5)7-4(2)6/h3H,2H2,1H3;3-6H,1-2H3 |
| InChIKey | BRJCWSIWJVZDQR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|