C9H16O3S — CID 142314857
4-(2-butylsulfanylethyl)-1,3-dioxolan-2-one (PubChem CID 142314857) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is 4-(2-butylsulfanylethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2-butylsulfanylethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 142314857 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 4-(2-butylsulfanylethyl)-1,3-dioxolan-2-one |
| SMILES | CCCCSCCC1COC(=O)O1 |
| InChI | InChI=1S/C9H16O3S/c1-2-3-5-13-6-4-8-7-11-9(10)12-8/h8H,2-7H2,1H3 |
| InChIKey | OLNUJRAJEHILFQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|