C8H14O3S — CID 14772134
5-(butoxymethyl)-1,3-oxathiolan-2-one (PubChem CID 14772134) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is 5-(butoxymethyl)-1,3-oxathiolan-2-one.
| Compound Name | 5-(butoxymethyl)-1,3-oxathiolan-2-one |
|---|---|
| PubChem CID | 14772134 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 5-(butoxymethyl)-1,3-oxathiolan-2-one |
| SMILES | CCCCOCC1CSC(=O)O1 |
| InChI | InChI=1S/C8H14O3S/c1-2-3-4-10-5-7-6-12-8(9)11-7/h7H,2-6H2,1H3 |
| InChIKey | LKFFWNXVBXATPC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|