C8H16O5 — CID 174922759
2-ethoxyethanol;4-methyl-1,3-dioxolan-2-one (PubChem CID 174922759) has the molecular formula C8H16O5 and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-ethoxyethanol;4-methyl-1,3-dioxolan-2-one.
| Compound Name | 2-ethoxyethanol;4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 174922759 |
| Molecular Formula | C8H16O5 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-ethoxyethanol;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1COC(=O)O1.CCOCCO |
| InChI | InChI=1S/C4H6O3.C4H10O2/c1-3-2-6-4(5)7-3;1-2-6-4-3-5/h3H,2H2,1H3;5H,2-4H2,1H3 |
| InChIKey | YKCJCRRBHLKHHU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|