C14H24O8 — CID 175300180
1,3-dioxolan-2-one;4-methyl-1,3-dioxolan-2-one;pentyl acetate (PubChem CID 175300180) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is 1,3-dioxolan-2-one;4-methyl-1,3-dioxolan-2-one;pentyl acetate.
| Compound Name | 1,3-dioxolan-2-one;4-methyl-1,3-dioxolan-2-one;pentyl acetate |
|---|---|
| PubChem CID | 175300180 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 1,3-dioxolan-2-one;4-methyl-1,3-dioxolan-2-one;pentyl acetate |
| SMILES | CC1COC(=O)O1.CCCCCOC(C)=O.O=C1OCCO1 |
| InChI | InChI=1S/C7H14O2.C4H6O3.C3H4O3/c1-3-4-5-6-9-7(2)8;1-3-2-6-4(5)7-3;4-3-5-1-2-6-3/h3-6H2,1-2H3;3H,2H2,1H3;1-2H2 |
| InChIKey | HTWQSIOPLVABJJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|