4-methyl-1,3-dioxolan-2-one;phthalic acid

C12H12O7 — CID 160550457

IUPAC4-methyl-1,3-dioxolan-2-one;phthalic acid
SMILESCC1COC(=O)O1.O=C(O)c1ccccc1C(=O)O
InChIInChI=1S/C8H6O4.C4H6O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3-2-6-4(5)7-3/h1-4H,(H,9,10)(H,11,12);3H,2H2,1H3
InChIKeyQXZMTDQINLTPAX-UHFFFAOYSA-N
MW268.22 g/mol
LogP1.62
Rot. Bonds2

About 4-methyl-1,3-dioxolan-2-one;phthalic acid

4-methyl-1,3-dioxolan-2-one;phthalic acid (PubChem CID 160550457) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;phthalic acid.

Molecular Properties

Compound Name4-methyl-1,3-dioxolan-2-one;phthalic acid
PubChem CID160550457
Molecular FormulaC12H12O7
Molecular Weight268.22 g/mol
Exact Mass268.06
IUPAC Name4-methyl-1,3-dioxolan-2-one;phthalic acid
SMILESCC1COC(=O)O1.O=C(O)c1ccccc1C(=O)O
InChIInChI=1S/C8H6O4.C4H6O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3-2-6-4(5)7-3/h1-4H,(H,9,10)(H,11,12);3H,2H2,1H3
InChIKeyQXZMTDQINLTPAX-UHFFFAOYSA-N
XLogP1.62
TPSA110.13 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.22
LogP ≤ 51.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 4-methyl-1,3-dioxolan-2-one;phthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methyl-1,3-dioxolan-2-one;phthalic acid?
The IUPAC name of 4-methyl-1,3-dioxolan-2-one;phthalic acid (CID 160550457) is 4-methyl-1,3-dioxolan-2-one;phthalic acid.
What is the SMILES notation for 4-methyl-1,3-dioxolan-2-one;phthalic acid?
The canonical SMILES for 4-methyl-1,3-dioxolan-2-one;phthalic acid is CC1COC(=O)O1.O=C(O)c1ccccc1C(=O)O.
What is the InChIKey of 4-methyl-1,3-dioxolan-2-one;phthalic acid?
The InChIKey is QXZMTDQINLTPAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.C4H6O3/c9-7(10)5-3-1-2-4-6(5)8(11)12;1-3-2-6-4(5)7-3/h1-4H,(H,9,10)(H,11,12);3H,2H2,1H3.
What are the key properties of 4-methyl-1,3-dioxolan-2-one;phthalic acid?
4-methyl-1,3-dioxolan-2-one;phthalic acid has a molecular weight of 268.22 g/mol, XLogP of 1.62, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxolan-2-one;phthalic acid is sourced from PubChem (CID 160550457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).