C14H14O7 — CID 174813314
4-ethenyl-1,3-dioxolan-2-one;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174813314) has the molecular formula C14H14O7 and a molecular weight of 294.26 g/mol. Its IUPAC name is 4-ethenyl-1,3-dioxolan-2-one;2-methylbenzene-1,3-dicarboxylic acid.
| Compound Name | 4-ethenyl-1,3-dioxolan-2-one;2-methylbenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 174813314 |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 4-ethenyl-1,3-dioxolan-2-one;2-methylbenzene-1,3-dicarboxylic acid |
| SMILES | C=CC1COC(=O)O1.Cc1c(C(=O)O)cccc1C(=O)O |
| InChI | InChI=1S/C9H8O4.C5H6O3/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;1-2-4-3-7-5(6)8-4/h2-4H,1H3,(H,10,11)(H,12,13);2,4H,1,3H2 |
| InChIKey | JGSBONXOTGFQCA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|