cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid

C15H20O5 — CID 174867146

IUPACcyclohexanol;2-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(C(=O)O)cccc1C(=O)O.OC1CCCCC1
InChIInChI=1S/C9H8O4.C6H12O/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;7-6-4-2-1-3-5-6/h2-4H,1H3,(H,10,11)(H,12,13);6-7H,1-5H2
InChIKeyXVMKPFRICOGGGZ-UHFFFAOYSA-N
MW280.32 g/mol
LogP2.70
Rot. Bonds2

About cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid

cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid (PubChem CID 174867146) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid.

Molecular Properties

Compound Namecyclohexanol;2-methylbenzene-1,3-dicarboxylic acid
PubChem CID174867146
Molecular FormulaC15H20O5
Molecular Weight280.32 g/mol
Exact Mass280.13
IUPAC Namecyclohexanol;2-methylbenzene-1,3-dicarboxylic acid
SMILESCc1c(C(=O)O)cccc1C(=O)O.OC1CCCCC1
InChIInChI=1S/C9H8O4.C6H12O/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;7-6-4-2-1-3-5-6/h2-4H,1H3,(H,10,11)(H,12,13);6-7H,1-5H2
InChIKeyXVMKPFRICOGGGZ-UHFFFAOYSA-N
XLogP2.70
TPSA94.83 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.32
LogP ≤ 52.70
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid?
The IUPAC name of cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid (CID 174867146) is cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid.
What is the SMILES notation for cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid?
The canonical SMILES for cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid is Cc1c(C(=O)O)cccc1C(=O)O.OC1CCCCC1.
What is the InChIKey of cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid?
The InChIKey is XVMKPFRICOGGGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4.C6H12O/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;7-6-4-2-1-3-5-6/h2-4H,1H3,(H,10,11)(H,12,13);6-7H,1-5H2.
What are the key properties of cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid?
cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid has a molecular weight of 280.32 g/mol, XLogP of 2.70, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;2-methylbenzene-1,3-dicarboxylic acid is sourced from PubChem (CID 174867146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).