C13H17NO5S — CID 63743648
3-(3-hydroxypiperidin-1-yl)sulfonyl-2-methylbenzoic acid (PubChem CID 63743648) has the molecular formula C13H17NO5S and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-(3-hydroxypiperidin-1-yl)sulfonyl-2-methylbenzoic acid.
| Compound Name | 3-(3-hydroxypiperidin-1-yl)sulfonyl-2-methylbenzoic acid |
|---|---|
| PubChem CID | 63743648 |
| Molecular Formula | C13H17NO5S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 3-(3-hydroxypiperidin-1-yl)sulfonyl-2-methylbenzoic acid |
| SMILES | Cc1c(C(=O)O)cccc1S(=O)(=O)N1CCCC(O)C1 |
| InChI | InChI=1S/C13H17NO5S/c1-9-11(13(16)17)5-2-6-12(9)20(18,19)14-7-3-4-10(15)8-14/h2,5-6,10,15H,3-4,7-8H2,1H3,(H,16,17) |
| InChIKey | NDYFHJVLUKVRPQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |