C12H14O6 — CID 161273560
2-methylbenzene-1,3-dicarboxylic acid;oxiran-2-ylmethanol (PubChem CID 161273560) has the molecular formula C12H14O6 and a molecular weight of 254.24 g/mol. Its IUPAC name is 2-methylbenzene-1,3-dicarboxylic acid;oxiran-2-ylmethanol.
| Compound Name | 2-methylbenzene-1,3-dicarboxylic acid;oxiran-2-ylmethanol |
|---|---|
| PubChem CID | 161273560 |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-methylbenzene-1,3-dicarboxylic acid;oxiran-2-ylmethanol |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)O.OCC1CO1 |
| InChI | InChI=1S/C9H8O4.C3H6O2/c1-5-6(8(10)11)3-2-4-7(5)9(12)13;4-1-3-2-5-3/h2-4H,1H3,(H,10,11)(H,12,13);3-4H,1-2H2 |
| InChIKey | YNSBIHKVIQFJGB-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|