C21H38O12 — CID 88933491
1-[2,3-bis[1-(2-hydroxypropanoyloxy)ethoxy]hexoxy]ethyl 2-hydroxypropanoate (PubChem CID 88933491) has the molecular formula C21H38O12 and a molecular weight of 482.52 g/mol. Its IUPAC name is 1-[2,3-bis[1-(2-hydroxypropanoyloxy)ethoxy]hexoxy]ethyl 2-hydroxypropanoate.
| Compound Name | 1-[2,3-bis[1-(2-hydroxypropanoyloxy)ethoxy]hexoxy]ethyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 88933491 |
| Molecular Formula | C21H38O12 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-[2,3-bis[1-(2-hydroxypropanoyloxy)ethoxy]hexoxy]ethyl 2-hydroxypropanoate |
| SMILES | CCCC(OC(C)OC(=O)C(C)O)C(COC(C)OC(=O)C(C)O)OC(C)OC(=O)C(C)O |
| InChI | InChI=1S/C21H38O12/c1-8-9-17(29-15(6)32-20(26)12(3)23)18(30-16(7)33-21(27)13(4)24)10-28-14(5)31-19(25)11(2)22/h11-18,22-24H,8-10H2,1-7H3 |
| InChIKey | RDCPXYSKFKOIHX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 167.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|