C13H22O3 — CID 91107431
1-(2-methylhexoxy)ethyl buta-2,3-dienoate (PubChem CID 91107431) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 1-(2-methylhexoxy)ethyl buta-2,3-dienoate.
| Compound Name | 1-(2-methylhexoxy)ethyl buta-2,3-dienoate |
|---|---|
| PubChem CID | 91107431 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 1-(2-methylhexoxy)ethyl buta-2,3-dienoate |
| SMILES | C=C=CC(=O)OC(C)OCC(C)CCCC |
| InChI | InChI=1S/C13H22O3/c1-5-7-9-11(3)10-15-12(4)16-13(14)8-6-2/h8,11-12H,2,5,7,9-10H2,1,3-4H3 |
| InChIKey | BETAFVLMSUXAQH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|