C8H12O2 — CID 86045289
2-methylpropyl buta-2,3-dienoate (PubChem CID 86045289) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-methylpropyl buta-2,3-dienoate.
| Compound Name | 2-methylpropyl buta-2,3-dienoate |
|---|---|
| PubChem CID | 86045289 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-methylpropyl buta-2,3-dienoate |
| SMILES | C=C=CC(=O)OCC(C)C |
| InChI | InChI=1S/C8H12O2/c1-4-5-8(9)10-6-7(2)3/h5,7H,1,6H2,2-3H3 |
| InChIKey | JTGQRDDKGYGLNS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|