C10H16O2 — CID 174631316
2-methylpropyl 2-methylpenta-2,3-dienoate (PubChem CID 174631316) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-methylpropyl 2-methylpenta-2,3-dienoate.
| Compound Name | 2-methylpropyl 2-methylpenta-2,3-dienoate |
|---|---|
| PubChem CID | 174631316 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-methylpropyl 2-methylpenta-2,3-dienoate |
| SMILES | CC=C=C(C)C(=O)OCC(C)C |
| InChI | InChI=1S/C10H16O2/c1-5-6-9(4)10(11)12-7-8(2)3/h5,8H,7H2,1-4H3 |
| InChIKey | IDCGFVGMMXGMEM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|