About bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene
bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene (PubChem CID 142644366) has the molecular formula C17H28O4
and a molecular weight of 296.41 g/mol. Its IUPAC name is bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene.
Molecular Properties
| Compound Name | bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene |
| PubChem CID | 142644366 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene |
| SMILES | C=C.C=C(/C=C(\C)C(=O)OCC(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H24O4.C2H4/c1-10(2)8-18-14(16)12(5)7-13(6)15(17)19-9-11(3)4;1-2/h7,10-11H,5,8-9H2,1-4,6H3;1-2H2/b13-7+; |
| InChIKey | HFKVICBJEVQECA-FTPOTTDRSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene?
The IUPAC name of bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene (CID 142644366) is bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene.
What is the SMILES notation for bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene?
The canonical SMILES for bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene is C=C.C=C(/C=C(\C)C(=O)OCC(C)C)C(=O)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene?
The InChIKey is HFKVICBJEVQECA-FTPOTTDRSA-N. The full InChI is InChI=1S/C15H24O4.C2H4/c1-10(2)8-18-14(16)12(5)7-13(6)15(17)19-9-11(3)4;1-2/h7,10-11H,5,8-9H2,1-4,6H3;1-2H2/b13-7+;.
What are the key properties of bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene?
bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene has a molecular weight of 296.41 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) (E)-2-methyl-4-methylidenepent-2-enedioate;ethene is sourced from PubChem (CID 142644366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).