C12H18O6 — CID 165175582
1-O-(1-hydroxyethyl) 5-O-(2-methoxyethyl) (E)-2-methyl-4-methylidenepent-2-enedioate (PubChem CID 165175582) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-O-(1-hydroxyethyl) 5-O-(2-methoxyethyl) (E)-2-methyl-4-methylidenepent-2-enedioate.
| Compound Name | 1-O-(1-hydroxyethyl) 5-O-(2-methoxyethyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
|---|---|
| PubChem CID | 165175582 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 1-O-(1-hydroxyethyl) 5-O-(2-methoxyethyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| SMILES | C=C(/C=C(\C)C(=O)OC(C)O)C(=O)OCCOC |
| InChI | InChI=1S/C12H18O6/c1-8(11(14)17-6-5-16-4)7-9(2)12(15)18-10(3)13/h7,10,13H,1,5-6H2,2-4H3/b9-7+ |
| InChIKey | BGQPBDLFWIQPHL-VQHVLOKHSA-N |
| XLogP | 0.56 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|