About bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate
bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate (PubChem CID 178067128) has the molecular formula C13H20O6
and a molecular weight of 272.30 g/mol. Its IUPAC name is bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate.
Molecular Properties
| Compound Name | bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| PubChem CID | 178067128 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| SMILES | C=C(/C=C(\C)C(=O)OCC(C)O)C(=O)OCC(C)O |
| InChI | InChI=1S/C13H20O6/c1-8(12(16)18-6-10(3)14)5-9(2)13(17)19-7-11(4)15/h5,10-11,14-15H,1,6-7H2,2-4H3/b9-5+ |
| InChIKey | YWOVMLYIIXUGHD-WEVVVXLNSA-N |
| XLogP | 0.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The IUPAC name of bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate (CID 178067128) is bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate.
What is the SMILES notation for bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The canonical SMILES for bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate is C=C(/C=C(\C)C(=O)OCC(C)O)C(=O)OCC(C)O.
What is the InChIKey of bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The InChIKey is YWOVMLYIIXUGHD-WEVVVXLNSA-N. The full InChI is InChI=1S/C13H20O6/c1-8(12(16)18-6-10(3)14)5-9(2)13(17)19-7-11(4)15/h5,10-11,14-15H,1,6-7H2,2-4H3/b9-5+.
What are the key properties of bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate has a molecular weight of 272.30 g/mol, XLogP of 0.34, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-hydroxypropyl) (E)-2-methyl-4-methylidenepent-2-enedioate is sourced from PubChem (CID 178067128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).