C18H26O7 — CID 88829049
methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid;prop-2-enal (PubChem CID 88829049) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid;prop-2-enal.
| Compound Name | methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid;prop-2-enal |
|---|---|
| PubChem CID | 88829049 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl 2-methylprop-2-enoate;4-(2-methylpropoxycarbonyl)penta-2,4-dienoic acid;prop-2-enal |
| SMILES | C=C(C)C(=O)OC.C=C(C=CC(=O)O)C(=O)OCC(C)C.C=CC=O |
| InChI | InChI=1S/C10H14O4.C5H8O2.C3H4O/c1-7(2)6-14-10(13)8(3)4-5-9(11)12;1-4(2)5(6)7-3;1-2-3-4/h4-5,7H,3,6H2,1-2H3,(H,11,12);1H2,2-3H3;2-3H,1H2 |
| InChIKey | NMBDYAQBCHBCEY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|