About 2-methylpropyl 2-tert-butylbut-2-enoate
2-methylpropyl 2-tert-butylbut-2-enoate (PubChem CID 174703085) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2-methylpropyl 2-tert-butylbut-2-enoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-tert-butylbut-2-enoate |
| PubChem CID | 174703085 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2-methylpropyl 2-tert-butylbut-2-enoate |
| SMILES | CC=C(C(=O)OCC(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-7-10(12(4,5)6)11(13)14-8-9(2)3/h7,9H,8H2,1-6H3 |
| InChIKey | UHLPNSQEJBUUHJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-tert-butylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-tert-butylbut-2-enoate?
The IUPAC name of 2-methylpropyl 2-tert-butylbut-2-enoate (CID 174703085) is 2-methylpropyl 2-tert-butylbut-2-enoate.
What is the SMILES notation for 2-methylpropyl 2-tert-butylbut-2-enoate?
The canonical SMILES for 2-methylpropyl 2-tert-butylbut-2-enoate is CC=C(C(=O)OCC(C)C)C(C)(C)C.
What is the InChIKey of 2-methylpropyl 2-tert-butylbut-2-enoate?
The InChIKey is UHLPNSQEJBUUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O2/c1-7-10(12(4,5)6)11(13)14-8-9(2)3/h7,9H,8H2,1-6H3.
What are the key properties of 2-methylpropyl 2-tert-butylbut-2-enoate?
2-methylpropyl 2-tert-butylbut-2-enoate has a molecular weight of 198.31 g/mol, XLogP of 3.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-tert-butylbut-2-enoate is sourced from PubChem (CID 174703085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).