C9H14N2O3 — CID 57201487
2-(carbamoylamino)ethyl 2-methylpenta-2,3-dienoate (PubChem CID 57201487) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-(carbamoylamino)ethyl 2-methylpenta-2,3-dienoate.
| Compound Name | 2-(carbamoylamino)ethyl 2-methylpenta-2,3-dienoate |
|---|---|
| PubChem CID | 57201487 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 2-(carbamoylamino)ethyl 2-methylpenta-2,3-dienoate |
| SMILES | CC=C=C(C)C(=O)OCCNC(N)=O |
| InChI | InChI=1S/C9H14N2O3/c1-3-4-7(2)8(12)14-6-5-11-9(10)13/h3H,5-6H2,1-2H3,(H3,10,11,13) |
| InChIKey | HCHINQFLQPYEMZ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|