C9H14O3 — CID 175303335
2-hydroxyethyl 2-methylhexa-2,3-dienoate (PubChem CID 175303335) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methylhexa-2,3-dienoate.
| Compound Name | 2-hydroxyethyl 2-methylhexa-2,3-dienoate |
|---|---|
| PubChem CID | 175303335 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2-hydroxyethyl 2-methylhexa-2,3-dienoate |
| SMILES | CCC=C=C(C)C(=O)OCCO |
| InChI | InChI=1S/C9H14O3/c1-3-4-5-8(2)9(11)12-7-6-10/h4,10H,3,6-7H2,1-2H3 |
| InChIKey | FOESQWGXRCENPV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|