About 2-(carbamoylamino)ethyl 2-chloroacetate
2-(carbamoylamino)ethyl 2-chloroacetate (PubChem CID 21179128) has the molecular formula C5H9ClN2O3
and a molecular weight of 180.59 g/mol. Its IUPAC name is 2-(carbamoylamino)ethyl 2-chloroacetate.
Molecular Properties
| Compound Name | 2-(carbamoylamino)ethyl 2-chloroacetate |
| PubChem CID | 21179128 |
| Molecular Formula | C5H9ClN2O3 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | 2-(carbamoylamino)ethyl 2-chloroacetate |
| SMILES | NC(=O)NCCOC(=O)CCl |
| InChI | InChI=1S/C5H9ClN2O3/c6-3-4(9)11-2-1-8-5(7)10/h1-3H2,(H3,7,8,10) |
| InChIKey | QXRYFPSVOHHZHQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(carbamoylamino)ethyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)ethyl 2-chloroacetate?
The IUPAC name of 2-(carbamoylamino)ethyl 2-chloroacetate (CID 21179128) is 2-(carbamoylamino)ethyl 2-chloroacetate.
What is the SMILES notation for 2-(carbamoylamino)ethyl 2-chloroacetate?
The canonical SMILES for 2-(carbamoylamino)ethyl 2-chloroacetate is NC(=O)NCCOC(=O)CCl.
What is the InChIKey of 2-(carbamoylamino)ethyl 2-chloroacetate?
The InChIKey is QXRYFPSVOHHZHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClN2O3/c6-3-4(9)11-2-1-8-5(7)10/h1-3H2,(H3,7,8,10).
What are the key properties of 2-(carbamoylamino)ethyl 2-chloroacetate?
2-(carbamoylamino)ethyl 2-chloroacetate has a molecular weight of 180.59 g/mol, XLogP of -0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)ethyl 2-chloroacetate is sourced from PubChem (CID 21179128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).