About 4-(methylamino)butyl 2-chloroacetate
4-(methylamino)butyl 2-chloroacetate (PubChem CID 161447305) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 4-(methylamino)butyl 2-chloroacetate.
Molecular Properties
| Compound Name | 4-(methylamino)butyl 2-chloroacetate |
| PubChem CID | 161447305 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-(methylamino)butyl 2-chloroacetate |
| SMILES | CNCCCCOC(=O)CCl |
| InChI | InChI=1S/C7H14ClNO2/c1-9-4-2-3-5-11-7(10)6-8/h9H,2-6H2,1H3 |
| InChIKey | YKPZIYUFGSGCJP-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(methylamino)butyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)butyl 2-chloroacetate?
The IUPAC name of 4-(methylamino)butyl 2-chloroacetate (CID 161447305) is 4-(methylamino)butyl 2-chloroacetate.
What is the SMILES notation for 4-(methylamino)butyl 2-chloroacetate?
The canonical SMILES for 4-(methylamino)butyl 2-chloroacetate is CNCCCCOC(=O)CCl.
What is the InChIKey of 4-(methylamino)butyl 2-chloroacetate?
The InChIKey is YKPZIYUFGSGCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO2/c1-9-4-2-3-5-11-7(10)6-8/h9H,2-6H2,1H3.
What are the key properties of 4-(methylamino)butyl 2-chloroacetate?
4-(methylamino)butyl 2-chloroacetate has a molecular weight of 179.65 g/mol, XLogP of 0.77, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)butyl 2-chloroacetate is sourced from PubChem (CID 161447305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).