About 12-acetylsulfanyldodecyl 2-chloroacetate
12-acetylsulfanyldodecyl 2-chloroacetate (PubChem CID 101437567) has the molecular formula C16H29ClO3S
and a molecular weight of 336.93 g/mol. Its IUPAC name is 12-acetylsulfanyldodecyl 2-chloroacetate.
Molecular Properties
| Compound Name | 12-acetylsulfanyldodecyl 2-chloroacetate |
| PubChem CID | 101437567 |
| Molecular Formula | C16H29ClO3S |
| Molecular Weight | 336.93 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 12-acetylsulfanyldodecyl 2-chloroacetate |
| SMILES | CC(=O)SCCCCCCCCCCCCOC(=O)CCl |
| InChI | InChI=1S/C16H29ClO3S/c1-15(18)21-13-11-9-7-5-3-2-4-6-8-10-12-20-16(19)14-17/h2-14H2,1H3 |
| InChIKey | YRQOWSBRHFWWSV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.93 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 12-acetylsulfanyldodecyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-acetylsulfanyldodecyl 2-chloroacetate?
The IUPAC name of 12-acetylsulfanyldodecyl 2-chloroacetate (CID 101437567) is 12-acetylsulfanyldodecyl 2-chloroacetate.
What is the SMILES notation for 12-acetylsulfanyldodecyl 2-chloroacetate?
The canonical SMILES for 12-acetylsulfanyldodecyl 2-chloroacetate is CC(=O)SCCCCCCCCCCCCOC(=O)CCl.
What is the InChIKey of 12-acetylsulfanyldodecyl 2-chloroacetate?
The InChIKey is YRQOWSBRHFWWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29ClO3S/c1-15(18)21-13-11-9-7-5-3-2-4-6-8-10-12-20-16(19)14-17/h2-14H2,1H3.
What are the key properties of 12-acetylsulfanyldodecyl 2-chloroacetate?
12-acetylsulfanyldodecyl 2-chloroacetate has a molecular weight of 336.93 g/mol, XLogP of 4.95, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-acetylsulfanyldodecyl 2-chloroacetate is sourced from PubChem (CID 101437567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).