C44H58O6S2 — CID 71740622
5-[4,5-bis(5-acetylsulfanylpentyl)-2-(5-benzoyloxypentyl)phenyl]pentyl benzoate (PubChem CID 71740622) has the molecular formula C44H58O6S2 and a molecular weight of 747.08 g/mol. Its IUPAC name is 5-[4,5-bis(5-acetylsulfanylpentyl)-2-(5-benzoyloxypentyl)phenyl]pentyl benzoate.
| Compound Name | 5-[4,5-bis(5-acetylsulfanylpentyl)-2-(5-benzoyloxypentyl)phenyl]pentyl benzoate |
|---|---|
| PubChem CID | 71740622 |
| Molecular Formula | C44H58O6S2 |
| Molecular Weight | 747.08 g/mol |
| Exact Mass | 746.37 |
| IUPAC Name | 5-[4,5-bis(5-acetylsulfanylpentyl)-2-(5-benzoyloxypentyl)phenyl]pentyl benzoate |
| SMILES | CC(=O)SCCCCCc1cc(CCCCCOC(=O)c2ccccc2)c(CCCCCOC(=O)c2ccccc2)cc1CCCCCSC(C)=O |
| InChI | InChI=1S/C44H58O6S2/c1-35(45)51-31-19-7-15-27-41-33-39(25-13-5-17-29-49-43(47)37-21-9-3-10-22-37)40(34-42(41)28-16-8-20-32-52-36(2)46)26-14-6-18-30-50-44(48)38-23-11-4-12-24-38/h3-4,9-12,21-24,33-34H,5-8,13-20,25-32H2,1-2H3 |
| InChIKey | KTYZHNUULSDIIA-UHFFFAOYSA-N |
| XLogP | 10.81 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.08 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|