C20H34O6S — CID 59422685
2-(2-prop-2-enoxyethoxy)ethyl 11-acetylsulfanyl-6-oxoundecanoate (PubChem CID 59422685) has the molecular formula C20H34O6S and a molecular weight of 402.55 g/mol. Its IUPAC name is 2-(2-prop-2-enoxyethoxy)ethyl 11-acetylsulfanyl-6-oxoundecanoate.
| Compound Name | 2-(2-prop-2-enoxyethoxy)ethyl 11-acetylsulfanyl-6-oxoundecanoate |
|---|---|
| PubChem CID | 59422685 |
| Molecular Formula | C20H34O6S |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 2-(2-prop-2-enoxyethoxy)ethyl 11-acetylsulfanyl-6-oxoundecanoate |
| SMILES | C=CCOCCOCCOC(=O)CCCCC(=O)CCCCCSC(C)=O |
| InChI | InChI=1S/C20H34O6S/c1-3-12-24-13-14-25-15-16-26-20(23)11-7-6-10-19(22)9-5-4-8-17-27-18(2)21/h3H,1,4-17H2,2H3 |
| InChIKey | AJCUHJJKPZURSN-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|