About cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate)
cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) (PubChem CID 102058822) has the molecular formula C16H22CdO8
and a molecular weight of 454.76 g/mol. Its IUPAC name is cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate).
Molecular Properties
| Compound Name | cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) |
| PubChem CID | 102058822 |
| Molecular Formula | C16H22CdO8 |
| Molecular Weight | 454.76 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) |
| SMILES | CC(C)COC(=O)/C=C\C(=O)[O-].CC(C)COC(=O)/C=C\C(=O)[O-].[Cd+2] |
| InChI | InChI=1S/2C8H12O4.Cd/c2*1-6(2)5-12-8(11)4-3-7(9)10;/h2*3-4,6H,5H2,1-2H3,(H,9,10);/q;;+2/p-2/b2*4-3-; |
| InChIKey | DWEVQUURSGETLQ-FDGPNNRMSA-L |
| XLogP | -1.02 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.76 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate)?
The IUPAC name of cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) (CID 102058822) is cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate).
What is the SMILES notation for cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate)?
The canonical SMILES for cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) is CC(C)COC(=O)/C=C\C(=O)[O-].CC(C)COC(=O)/C=C\C(=O)[O-].[Cd+2].
What is the InChIKey of cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate)?
The InChIKey is DWEVQUURSGETLQ-FDGPNNRMSA-L. The full InChI is InChI=1S/2C8H12O4.Cd/c2*1-6(2)5-12-8(11)4-3-7(9)10;/h2*3-4,6H,5H2,1-2H3,(H,9,10);/q;;+2/p-2/b2*4-3-;.
What are the key properties of cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate)?
cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) has a molecular weight of 454.76 g/mol, XLogP of -1.02, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis((Z)-4-(2-methylpropoxy)-4-oxobut-2-enoate) is sourced from PubChem (CID 102058822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).