About but-3-enyl (2R)-oxolane-2-carboxylate
but-3-enyl (2R)-oxolane-2-carboxylate (PubChem CID 101466422) has the molecular formula C9H14O3
and a molecular weight of 170.21 g/mol. Its IUPAC name is but-3-enyl (2R)-oxolane-2-carboxylate.
Molecular Properties
| Compound Name | but-3-enyl (2R)-oxolane-2-carboxylate |
| PubChem CID | 101466422 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | but-3-enyl (2R)-oxolane-2-carboxylate |
| SMILES | C=CCCOC(=O)[C@H]1CCCO1 |
| InChI | InChI=1S/C9H14O3/c1-2-3-6-12-9(10)8-5-4-7-11-8/h2,8H,1,3-7H2/t8-/m1/s1 |
| InChIKey | XQGZOJMDRQCZEC-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze but-3-enyl (2R)-oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-enyl (2R)-oxolane-2-carboxylate?
The IUPAC name of but-3-enyl (2R)-oxolane-2-carboxylate (CID 101466422) is but-3-enyl (2R)-oxolane-2-carboxylate.
What is the SMILES notation for but-3-enyl (2R)-oxolane-2-carboxylate?
The canonical SMILES for but-3-enyl (2R)-oxolane-2-carboxylate is C=CCCOC(=O)[C@H]1CCCO1.
What is the InChIKey of but-3-enyl (2R)-oxolane-2-carboxylate?
The InChIKey is XQGZOJMDRQCZEC-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H14O3/c1-2-3-6-12-9(10)8-5-4-7-11-8/h2,8H,1,3-7H2/t8-/m1/s1.
What are the key properties of but-3-enyl (2R)-oxolane-2-carboxylate?
but-3-enyl (2R)-oxolane-2-carboxylate has a molecular weight of 170.21 g/mol, XLogP of 1.28, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-enyl (2R)-oxolane-2-carboxylate is sourced from PubChem (CID 101466422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).