C16H17NO5 — CID 110495047
3-(1,3-dioxoisoindol-2-yl)propyl oxolane-2-carboxylate (PubChem CID 110495047) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)propyl oxolane-2-carboxylate.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)propyl oxolane-2-carboxylate |
|---|---|
| PubChem CID | 110495047 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)propyl oxolane-2-carboxylate |
| SMILES | O=C(OCCCN1C(=O)c2ccccc2C1=O)C1CCCO1 |
| InChI | InChI=1S/C16H17NO5/c18-14-11-5-1-2-6-12(11)15(19)17(14)8-4-10-22-16(20)13-7-3-9-21-13/h1-2,5-6,13H,3-4,7-10H2 |
| InChIKey | ZYFRWPCLPXYXDL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|