C13H20O3 — CID 146800638
4-deca-1,9-dienyl-1,3-dioxolan-2-one (PubChem CID 146800638) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 4-deca-1,9-dienyl-1,3-dioxolan-2-one.
| Compound Name | 4-deca-1,9-dienyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 146800638 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 4-deca-1,9-dienyl-1,3-dioxolan-2-one |
| SMILES | C=CCCCCCCC=CC1COC(=O)O1 |
| InChI | InChI=1S/C13H20O3/c1-2-3-4-5-6-7-8-9-10-12-11-15-13(14)16-12/h2,9-10,12H,1,3-8,11H2 |
| InChIKey | RXVCIQYPXNFFNH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|