C35H56O5 — CID 161112705
4-[(2E,10E,18E,26E)-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one (PubChem CID 161112705) has the molecular formula C35H56O5 and a molecular weight of 556.83 g/mol. Its IUPAC name is 4-[(2E,10E,18E,26E)-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one.
| Compound Name | 4-[(2E,10E,18E,26E)-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 161112705 |
| Molecular Formula | C35H56O5 |
| Molecular Weight | 556.83 g/mol |
| Exact Mass | 556.41 |
| IUPAC Name | 4-[(2E,10E,18E,26E)-28-(2-methylidene-1,3-dioxolan-4-yl)octacosa-2,10,18,26-tetraenyl]-1,3-dioxolan-2-one |
| SMILES | C=C1OCC(C/C=C/CCCCCC/C=C/CCCCCC/C=C/CCCCCC/C=C/CC2COC(=O)O2)O1 |
| InChI | InChI=1S/C35H56O5/c1-32-37-30-33(39-32)28-26-24-22-20-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-21-23-25-27-29-34-31-38-35(36)40-34/h8-11,24-27,33-34H,1-7,12-23,28-31H2/b10-8+,11-9+,26-24+,27-25+ |
| InChIKey | WEFOALGWSYAPRP-ZJKRRBSTSA-N |
| XLogP | 10.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.83 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|