C19H35NO3 — CID 18996041
5-amino-4-[(E)-pentadec-1-enyl]-1,3-dioxan-2-one (PubChem CID 18996041) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is 5-amino-4-[(E)-pentadec-1-enyl]-1,3-dioxan-2-one.
| Compound Name | 5-amino-4-[(E)-pentadec-1-enyl]-1,3-dioxan-2-one |
|---|---|
| PubChem CID | 18996041 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 5-amino-4-[(E)-pentadec-1-enyl]-1,3-dioxan-2-one |
| SMILES | CCCCCCCCCCCCC/C=C/C1OC(=O)OCC1N |
| InChI | InChI=1S/C19H35NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-17(20)16-22-19(21)23-18/h14-15,17-18H,2-13,16,20H2,1H3/b15-14+ |
| InChIKey | CVJUESHCEZXWGK-CCEZHUSRSA-N |
| XLogP | 5.11 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|