C19H34FNO2 — CID 58743259
(4R,5R)-4-(fluoromethyl)-5-[(E)-pentadec-1-enyl]-1,3-oxazolidin-2-one (PubChem CID 58743259) has the molecular formula C19H34FNO2 and a molecular weight of 327.48 g/mol. Its IUPAC name is (4R,5R)-4-(fluoromethyl)-5-[(E)-pentadec-1-enyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-(fluoromethyl)-5-[(E)-pentadec-1-enyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58743259 |
| Molecular Formula | C19H34FNO2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.26 |
| IUPAC Name | (4R,5R)-4-(fluoromethyl)-5-[(E)-pentadec-1-enyl]-1,3-oxazolidin-2-one |
| SMILES | CCCCCCCCCCCCC/C=C/[C@H]1OC(=O)N[C@H]1CF |
| InChI | InChI=1S/C19H34FNO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18-17(16-20)21-19(22)23-18/h14-15,17-18H,2-13,16H2,1H3,(H,21,22)/b15-14+/t17-,18+/m0/s1 |
| InChIKey | RNJKIOPFBMSVPG-KRWOKUGFSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|