C17H21NO4 — CID 70896830
methyl (E)-6-[(4S,5S)-4-benzyl-2-oxo-1,3-oxazolidin-5-yl]hex-5-enoate (PubChem CID 70896830) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl (E)-6-[(4S,5S)-4-benzyl-2-oxo-1,3-oxazolidin-5-yl]hex-5-enoate.
| Compound Name | methyl (E)-6-[(4S,5S)-4-benzyl-2-oxo-1,3-oxazolidin-5-yl]hex-5-enoate |
|---|---|
| PubChem CID | 70896830 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl (E)-6-[(4S,5S)-4-benzyl-2-oxo-1,3-oxazolidin-5-yl]hex-5-enoate |
| SMILES | COC(=O)CCC/C=C/[C@@H]1OC(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO4/c1-21-16(19)11-7-3-6-10-15-14(18-17(20)22-15)12-13-8-4-2-5-9-13/h2,4-6,8-10,14-15H,3,7,11-12H2,1H3,(H,18,20)/b10-6+/t14-,15-/m0/s1 |
| InChIKey | DTZQCMAJWSGESX-LZPJFDPBSA-N |
| XLogP | 2.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|