C15H18INO2 — CID 135027570
(4S,5S)-4-benzyl-5-[(E,2S)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one (PubChem CID 135027570) has the molecular formula C15H18INO2 and a molecular weight of 371.22 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-5-[(E,2S)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-4-benzyl-5-[(E,2S)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 135027570 |
| Molecular Formula | C15H18INO2 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (4S,5S)-4-benzyl-5-[(E,2S)-4-iodopent-3-en-2-yl]-1,3-oxazolidin-2-one |
| SMILES | C/C(I)=C\[C@H](C)[C@@H]1OC(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C15H18INO2/c1-10(8-11(2)16)14-13(17-15(18)19-14)9-12-6-4-3-5-7-12/h3-8,10,13-14H,9H2,1-2H3,(H,17,18)/b11-8+/t10-,13-,14-/m0/s1 |
| InChIKey | GINDTQAMACDWGG-XKMHKDLLSA-N |
| XLogP | 3.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|