C17H13F3INO2 — CID 66716628
(4R,5R)-4-benzyl-5-[2-iodo-5-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 66716628) has the molecular formula C17H13F3INO2 and a molecular weight of 447.19 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-5-[2-iodo-5-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R,5R)-4-benzyl-5-[2-iodo-5-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 66716628 |
| Molecular Formula | C17H13F3INO2 |
| Molecular Weight | 447.19 g/mol |
| Exact Mass | 446.99 |
| IUPAC Name | (4R,5R)-4-benzyl-5-[2-iodo-5-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](Cc2ccccc2)[C@@H](c2cc(C(F)(F)F)ccc2I)O1 |
| InChI | InChI=1S/C17H13F3INO2/c18-17(19,20)11-6-7-13(21)12(9-11)15-14(22-16(23)24-15)8-10-4-2-1-3-5-10/h1-7,9,14-15H,8H2,(H,22,23)/t14-,15-/m1/s1 |
| InChIKey | MBYHGYQAEFIJEG-HUUCEWRRSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|