C17H14F3NO — CID 102325825
3-benzyl-1-methyl-5-(trifluoromethyl)-3H-indol-2-one (PubChem CID 102325825) has the molecular formula C17H14F3NO and a molecular weight of 305.30 g/mol. Its IUPAC name is 3-benzyl-1-methyl-5-(trifluoromethyl)-3H-indol-2-one.
| Compound Name | 3-benzyl-1-methyl-5-(trifluoromethyl)-3H-indol-2-one |
|---|---|
| PubChem CID | 102325825 |
| Molecular Formula | C17H14F3NO |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-benzyl-1-methyl-5-(trifluoromethyl)-3H-indol-2-one |
| SMILES | CN1C(=O)C(Cc2ccccc2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H14F3NO/c1-21-15-8-7-12(17(18,19)20)10-13(15)14(16(21)22)9-11-5-3-2-4-6-11/h2-8,10,14H,9H2,1H3 |
| InChIKey | ZNJNEQIMHYTMKT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |