C16H31NO2 — CID 67672310
(2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-amine (PubChem CID 67672310) has the molecular formula C16H31NO2 and a molecular weight of 269.43 g/mol. Its IUPAC name is (2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-amine.
| Compound Name | (2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-amine |
|---|---|
| PubChem CID | 67672310 |
| Molecular Formula | C16H31NO2 |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.24 |
| IUPAC Name | (2S,3R,4S,5S)-4-methoxy-5-methyl-2-non-1-enyloxan-3-amine |
| SMILES | CCCCCCCC=C[C@@H]1OC[C@H](C)[C@H](OC)[C@H]1N |
| InChI | InChI=1S/C16H31NO2/c1-4-5-6-7-8-9-10-11-14-15(17)16(18-3)13(2)12-19-14/h10-11,13-16H,4-9,12,17H2,1-3H3/t13-,14-,15-,16-/m0/s1 |
| InChIKey | RCOQSTLPSFZWSN-VGWMRTNUSA-N |
| XLogP | 3.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|