C19H35NO4 — CID 67879762
[(2R,3R,4R,5S)-2-dec-1-enyl-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate (PubChem CID 67879762) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2-dec-1-enyl-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate.
| Compound Name | [(2R,3R,4R,5S)-2-dec-1-enyl-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate |
|---|---|
| PubChem CID | 67879762 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | [(2R,3R,4R,5S)-2-dec-1-enyl-4-methoxy-5-methyloxan-3-yl] 2-aminoacetate |
| SMILES | CCCCCCCCC=C[C@H]1OC[C@H](C)[C@@H](OC)[C@H]1OC(=O)CN |
| InChI | InChI=1S/C19H35NO4/c1-4-5-6-7-8-9-10-11-12-16-19(24-17(21)13-20)18(22-3)15(2)14-23-16/h11-12,15-16,18-19H,4-10,13-14,20H2,1-3H3/t15-,16+,18+,19-/m0/s1 |
| InChIKey | FRSNUZWHTMCPAM-ISARSNTHSA-N |
| XLogP | 3.21 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|