C26H38F3NO7 — CID 22856016
[(2S,3R,4S,5R)-4-methoxy-2-[(E)-non-1-enyl]-5-phenylmethoxyoxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid (PubChem CID 22856016) has the molecular formula C26H38F3NO7 and a molecular weight of 533.58 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4-methoxy-2-[(E)-non-1-enyl]-5-phenylmethoxyoxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid.
| Compound Name | [(2S,3R,4S,5R)-4-methoxy-2-[(E)-non-1-enyl]-5-phenylmethoxyoxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22856016 |
| Molecular Formula | C26H38F3NO7 |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | [(2S,3R,4S,5R)-4-methoxy-2-[(E)-non-1-enyl]-5-phenylmethoxyoxan-3-yl] 2-aminoacetate;2,2,2-trifluoroacetic acid |
| SMILES | CCCCCCC/C=C/[C@@H]1OC[C@@H](OCc2ccccc2)[C@H](OC)[C@@H]1OC(=O)CN.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H37NO5.C2HF3O2/c1-3-4-5-6-7-8-12-15-20-24(30-22(26)16-25)23(27-2)21(18-29-20)28-17-19-13-10-9-11-14-19;3-2(4,5)1(6)7/h9-15,20-21,23-24H,3-8,16-18,25H2,1-2H3;(H,6,7)/b15-12+;/t20-,21+,23-,24+;/m0./s1 |
| InChIKey | FWGFVBMEUMXUFM-KPJOWBDPSA-N |
| XLogP | 4.41 |
| TPSA | 117.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|